About ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine
ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine (PubChem CID 156737443) has the molecular formula C11H21NO
and a molecular weight of 183.30 g/mol. Its IUPAC name is ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 156737443 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC1=CCN(C2COC2)CC1 |
| InChI | InChI=1S/C9H15NO.C2H6/c1-8-2-4-10(5-3-8)9-6-11-7-9;1-2/h2,9H,3-7H2,1H3;1-2H3 |
| InChIKey | DNPBRBYHISTOFX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine (CID 156737443) is ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine is CC.CC1=CCN(C2COC2)CC1.
What is the InChIKey of ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is DNPBRBYHISTOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO.C2H6/c1-8-2-4-10(5-3-8)9-6-11-7-9;1-2/h2,9H,3-7H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine?
ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 183.30 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1-(oxetan-3-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 156737443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).