About (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal
(2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal (PubChem CID 156737531) has the molecular formula C27H53NO3
and a molecular weight of 439.73 g/mol. Its IUPAC name is (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal.
Molecular Properties
| Compound Name | (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal |
| PubChem CID | 156737531 |
| Molecular Formula | C27H53NO3 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.40 |
| IUPAC Name | (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal |
| SMILES | CCCCCCCC/C=C\CCCCCCCC=O.CCCOOC[C@@H]1CCCN1C |
| InChI | InChI=1S/C18H34O.C9H19NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3-7-11-12-8-9-5-4-6-10(9)2/h9-10,18H,2-8,11-17H2,1H3;9H,3-8H2,1-2H3/b10-9-;/t;9-/m.0/s1 |
| InChIKey | BBMBBNKMGZDWOC-RIVSINODSA-N |
| XLogP | 7.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal?
The IUPAC name of (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal (CID 156737531) is (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal.
What is the SMILES notation for (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal?
The canonical SMILES for (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal is CCCCCCCC/C=C\CCCCCCCC=O.CCCOOC[C@@H]1CCCN1C.
What is the InChIKey of (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal?
The InChIKey is BBMBBNKMGZDWOC-RIVSINODSA-N. The full InChI is InChI=1S/C18H34O.C9H19NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3-7-11-12-8-9-5-4-6-10(9)2/h9-10,18H,2-8,11-17H2,1H3;9H,3-8H2,1-2H3/b10-9-;/t;9-/m.0/s1.
What are the key properties of (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal?
(2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal has a molecular weight of 439.73 g/mol, XLogP of 7.66, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-methyl-2-(propylperoxymethyl)pyrrolidine;(Z)-octadec-9-enal is sourced from PubChem (CID 156737531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).