About N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide
N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide (PubChem CID 156737671) has the molecular formula C30H33NOPo
and a molecular weight of 632.60 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide.
Molecular Properties
| Compound Name | N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide |
| PubChem CID | 156737671 |
| Molecular Formula | C30H33NOPo |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide |
| SMILES | CCC(C(=O)NC1=C(C)CCC=C1C)[Po](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H18NO.3C6H5.Po/c1-4-6-11(14)13-12-9(2)7-5-8-10(12)3;3*1-2-4-6-5-3-1;/h6-7H,4-5,8H2,1-3H3,(H,13,14);3*1-5H; |
| InChIKey | CYKNZEDZJMHVQW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide?
The IUPAC name of N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide (CID 156737671) is N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide.
What is the SMILES notation for N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide?
The canonical SMILES for N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide is CCC(C(=O)NC1=C(C)CCC=C1C)[Po](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide?
The InChIKey is CYKNZEDZJMHVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18NO.3C6H5.Po/c1-4-6-11(14)13-12-9(2)7-5-8-10(12)3;3*1-2-4-6-5-3-1;/h6-7H,4-5,8H2,1-3H3,(H,13,14);3*1-5H;.
What are the key properties of N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide?
N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide has a molecular weight of 632.60 g/mol, XLogP of 5.07, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-2-(triphenyl-λ4-polanyl)butanamide is sourced from PubChem (CID 156737671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).