About (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine
(3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine (PubChem CID 156737688) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine |
| PubChem CID | 156737688 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C)OC)NCC |
| InChI | InChI=1S/C9H15NO/c1-5-9(10-6-2)7-8(3)11-4/h5,7,10H,1,3,6H2,2,4H3/b9-7+ |
| InChIKey | TVEVNJNLEPDGAG-VQHVLOKHSA-N |
| XLogP | 1.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine?
The IUPAC name of (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine (CID 156737688) is (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine.
What is the SMILES notation for (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine?
The canonical SMILES for (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine is C=C/C(=C\C(=C)OC)NCC.
What is the InChIKey of (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine?
The InChIKey is TVEVNJNLEPDGAG-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H15NO/c1-5-9(10-6-2)7-8(3)11-4/h5,7,10H,1,3,6H2,2,4H3/b9-7+.
What are the key properties of (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine?
(3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine has a molecular weight of 153.22 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-ethyl-5-methoxyhexa-1,3,5-trien-3-amine is sourced from PubChem (CID 156737688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).