C13H25N3O — CID 156737866
ethane;N-(3-methyl-1,3-diazinan-4-yl)-N-[(Z)-prop-1-enyl]prop-2-enamide (PubChem CID 156737866) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;N-(3-methyl-1,3-diazinan-4-yl)-N-[(Z)-prop-1-enyl]prop-2-enamide.
| Compound Name | ethane;N-(3-methyl-1,3-diazinan-4-yl)-N-[(Z)-prop-1-enyl]prop-2-enamide |
|---|---|
| PubChem CID | 156737866 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | ethane;N-(3-methyl-1,3-diazinan-4-yl)-N-[(Z)-prop-1-enyl]prop-2-enamide |
| SMILES | C=CC(=O)N(/C=C\C)C1CCNCN1C.CC |
| InChI | InChI=1S/C11H19N3O.C2H6/c1-4-8-14(11(15)5-2)10-6-7-12-9-13(10)3;1-2/h4-5,8,10,12H,2,6-7,9H2,1,3H3;1-2H3/b8-4-; |
| InChIKey | IDAPXHOAAOTUAF-ZYFYRQFPSA-N |
| XLogP | 1.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|