C15H15F5N4O2S — CID 156738047
3-[5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methyl-1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]urea (PubChem CID 156738047) has the molecular formula C15H15F5N4O2S and a molecular weight of 410.37 g/mol. Its IUPAC name is 3-[5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methyl-1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]urea.
| Compound Name | 3-[5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methyl-1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]urea |
|---|---|
| PubChem CID | 156738047 |
| Molecular Formula | C15H15F5N4O2S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-[5-[(3,5-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1-methyl-1-[(2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropyl]urea |
| SMILES | CN(C[C@](C)(O)C(F)(F)F)C(=O)Nc1nnc(Cc2cc(F)cc(F)c2)s1 |
| InChI | InChI=1S/C15H15F5N4O2S/c1-14(26,15(18,19)20)7-24(2)13(25)21-12-23-22-11(27-12)5-8-3-9(16)6-10(17)4-8/h3-4,6,26H,5,7H2,1-2H3,(H,21,23,25)/t14-/m0/s1 |
| InChIKey | SBAKHDVCQFDROZ-AWEZNQCLSA-N |
| XLogP | 3.18 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |