C24H24FN3O2 — CID 156738587
3-(3,4-dimethylphenyl)-7-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]-hydroxymethyl]-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 156738587) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-7-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]-hydroxymethyl]-2H-pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 3-(3,4-dimethylphenyl)-7-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]-hydroxymethyl]-2H-pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 156738587 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-7-[[[(1R)-1-(4-fluorophenyl)ethyl]amino]-hydroxymethyl]-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | Cc1ccc(-c2cn3cc(C(O)N[C@H](C)c4ccc(F)cc4)cc3c(=O)[nH]2)cc1C |
| InChI | InChI=1S/C24H24FN3O2/c1-14-4-5-18(10-15(14)2)21-13-28-12-19(11-22(28)24(30)27-21)23(29)26-16(3)17-6-8-20(25)9-7-17/h4-13,16,23,26,29H,1-3H3,(H,27,30)/t16-,23?/m1/s1 |
| InChIKey | YDUKCQBGXVZOGW-ADRQNKRLSA-N |
| XLogP | 4.39 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|