C20H17NO2 — CID 156739257
4-methoxy-N,2-diphenylbenzamide (PubChem CID 156739257) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-methoxy-N,2-diphenylbenzamide.
| Compound Name | 4-methoxy-N,2-diphenylbenzamide |
|---|---|
| PubChem CID | 156739257 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-methoxy-N,2-diphenylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H17NO2/c1-23-17-12-13-18(19(14-17)15-8-4-2-5-9-15)20(22)21-16-10-6-3-7-11-16/h2-14H,1H3,(H,21,22) |
| InChIKey | CLJDLJKMQGWECP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |