C26H32O2S — CID 15673976
(8R,9S,10R,13S,14S)-10,13-dimethyl-4-(phenylsulfanylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 15673976) has the molecular formula C26H32O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-4-(phenylsulfanylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4-(phenylsulfanylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 15673976 |
| Molecular Formula | C26H32O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-4-(phenylsulfanylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C(CSc3ccccc3)=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H32O2S/c1-25-15-13-23(27)19(16-29-17-6-4-3-5-7-17)21(25)9-8-18-20-10-11-24(28)26(20,2)14-12-22(18)25/h3-7,18,20,22H,8-16H2,1-2H3/t18-,20-,22-,25-,26-/m0/s1 |
| InChIKey | UOVKWFSUIIXOHN-ABNAAPPCSA-N |
| XLogP | 6.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |