C17H18ClFN8O2S — CID 156740814
1-(2-chloro-5-fluoro-3-pyridinyl)ethyl N-[3-methyl-5-[5-(methylaminosulfanylamino)-2-pyridinyl]triazol-4-yl]carbamate (PubChem CID 156740814) has the molecular formula C17H18ClFN8O2S and a molecular weight of 452.90 g/mol. Its IUPAC name is 1-(2-chloro-5-fluoro-3-pyridinyl)ethyl N-[3-methyl-5-[5-(methylaminosulfanylamino)-2-pyridinyl]triazol-4-yl]carbamate.
| Compound Name | 1-(2-chloro-5-fluoro-3-pyridinyl)ethyl N-[3-methyl-5-[5-(methylaminosulfanylamino)-2-pyridinyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 156740814 |
| Molecular Formula | C17H18ClFN8O2S |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 1-(2-chloro-5-fluoro-3-pyridinyl)ethyl N-[3-methyl-5-[5-(methylaminosulfanylamino)-2-pyridinyl]triazol-4-yl]carbamate |
| SMILES | CNSNc1ccc(-c2nnn(C)c2NC(=O)OC(C)c2cc(F)cnc2Cl)nc1 |
| InChI | InChI=1S/C17H18ClFN8O2S/c1-9(12-6-10(19)7-22-15(12)18)29-17(28)23-16-14(24-26-27(16)3)13-5-4-11(8-21-13)25-30-20-2/h4-9,20,25H,1-3H3,(H,23,28) |
| InChIKey | WCXFJUPHRFRSHD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|