About CID 156741031
CID 156741031 (PubChem CID 156741031) has the molecular formula C11H17BN4O2
and a molecular weight of 248.09 g/mol.
Molecular Properties
| Compound Name | CID 156741031 |
| PubChem CID | 156741031 |
| Molecular Formula | C11H17BN4O2 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | — |
| SMILES | [B]Cc1cnc(NCC(=O)OCC)c(NCC)n1 |
| InChI | InChI=1S/C11H17BN4O2/c1-3-13-11-10(14-6-8(5-12)16-11)15-7-9(17)18-4-2/h6H,3-5,7H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | CQRBKZLZPNSWIF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156741031 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156741031?
The IUPAC name of CID 156741031 (CID 156741031) is not available.
What is the SMILES notation for CID 156741031?
The canonical SMILES for CID 156741031 is [B]Cc1cnc(NCC(=O)OCC)c(NCC)n1.
What is the InChIKey of CID 156741031?
The InChIKey is CQRBKZLZPNSWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BN4O2/c1-3-13-11-10(14-6-8(5-12)16-11)15-7-9(17)18-4-2/h6H,3-5,7H2,1-2H3,(H,13,16)(H,14,15).
What are the key properties of CID 156741031?
CID 156741031 has a molecular weight of 248.09 g/mol, XLogP of 0.55, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156741031 is sourced from PubChem (CID 156741031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).