About CID 156741079
CID 156741079 (PubChem CID 156741079) has the molecular formula C32H50BF3OS
and a molecular weight of 550.62 g/mol.
Molecular Properties
| Compound Name | CID 156741079 |
| PubChem CID | 156741079 |
| Molecular Formula | C32H50BF3OS |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]C(C)SC(C(/C=C(\C)OCC(F)(F)C(C)(C)C)=C/C=C(\C)F)=C(\C)c1ccccc1C(C)C |
| InChI | InChI=1S/C28H38BF3OS.2C2H6/c1-18(2)24-12-10-11-13-25(24)21(5)26(34-22(6)29)23(15-14-19(3)30)16-20(4)33-17-28(31,32)27(7,8)9;2*1-2/h10-16,18,22H,17H2,1-9H3;2*1-2H3/b19-14+,20-16+,23-15+,26-21+;; |
| InChIKey | LOLOGWFTWKBYLC-GKDYGYKFSA-N |
| XLogP | 11.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 156741079 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156741079?
The IUPAC name of CID 156741079 (CID 156741079) is not available.
What is the SMILES notation for CID 156741079?
The canonical SMILES for CID 156741079 is CC.CC.[B]C(C)SC(C(/C=C(\C)OCC(F)(F)C(C)(C)C)=C/C=C(\C)F)=C(\C)c1ccccc1C(C)C.
What is the InChIKey of CID 156741079?
The InChIKey is LOLOGWFTWKBYLC-GKDYGYKFSA-N. The full InChI is InChI=1S/C28H38BF3OS.2C2H6/c1-18(2)24-12-10-11-13-25(24)21(5)26(34-22(6)29)23(15-14-19(3)30)16-20(4)33-17-28(31,32)27(7,8)9;2*1-2/h10-16,18,22H,17H2,1-9H3;2*1-2H3/b19-14+,20-16+,23-15+,26-21+;;.
What are the key properties of CID 156741079?
CID 156741079 has a molecular weight of 550.62 g/mol, XLogP of 11.24, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156741079 is sourced from PubChem (CID 156741079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).