About N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide
N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide (PubChem CID 156741292) has the molecular formula C16H19F2N3O2
and a molecular weight of 323.34 g/mol. Its IUPAC name is N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide |
| PubChem CID | 156741292 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ncc(OC)c(C=CC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-3-14(22)21-15-19-10-13(23-2)12(20-15)5-4-11-6-8-16(17,18)9-7-11/h3-5,10-11H,1,6-9H2,2H3,(H,19,20,21,22) |
| InChIKey | KSSVWZZBMJWJBV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide?
The IUPAC name of N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide (CID 156741292) is N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide.
What is the SMILES notation for N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide?
The canonical SMILES for N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide is C=CC(=O)Nc1ncc(OC)c(C=CC2CCC(F)(F)CC2)n1.
What is the InChIKey of N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide?
The InChIKey is KSSVWZZBMJWJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3O2/c1-3-14(22)21-15-19-10-13(23-2)12(20-15)5-4-11-6-8-16(17,18)9-7-11/h3-5,10-11H,1,6-9H2,2H3,(H,19,20,21,22).
What are the key properties of N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide?
N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide has a molecular weight of 323.34 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxypyrimidin-2-yl]prop-2-enamide is sourced from PubChem (CID 156741292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).