About 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine
3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine (PubChem CID 156741354) has the molecular formula C25H48FN
and a molecular weight of 381.66 g/mol. Its IUPAC name is 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine |
| PubChem CID | 156741354 |
| Molecular Formula | C25H48FN |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 381.38 |
| IUPAC Name | 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine |
| SMILES | C=C(C)C(CCC)CC(CCCC1CC(C)(F)C1)CCN(CCC)CCC |
| InChI | InChI=1S/C25H48FN/c1-7-11-24(21(4)5)18-22(14-17-27(15-8-2)16-9-3)12-10-13-23-19-25(6,26)20-23/h22-24H,4,7-20H2,1-3,5-6H3 |
| InChIKey | WNNZLTKKQNJHJM-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine?
The IUPAC name of 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine (CID 156741354) is 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine.
What is the SMILES notation for 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine?
The canonical SMILES for 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine is C=C(C)C(CCC)CC(CCCC1CC(C)(F)C1)CCN(CCC)CCC.
What is the InChIKey of 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine?
The InChIKey is WNNZLTKKQNJHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48FN/c1-7-11-24(21(4)5)18-22(14-17-27(15-8-2)16-9-3)12-10-13-23-19-25(6,26)20-23/h22-24H,4,7-20H2,1-3,5-6H3.
What are the key properties of 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine?
3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine has a molecular weight of 381.66 g/mol, XLogP of 7.81, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-fluoro-3-methylcyclobutyl)propyl]-5-prop-1-en-2-yl-N,N-dipropyloctan-1-amine is sourced from PubChem (CID 156741354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).