About (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+)
(4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) (PubChem CID 156741367) has the molecular formula C9H18NO2Rb
and a molecular weight of 257.72 g/mol. Its IUPAC name is (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+).
Molecular Properties
| Compound Name | (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) |
| PubChem CID | 156741367 |
| Molecular Formula | C9H18NO2Rb |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) |
| SMILES | CC.CC(=O)C1([NH-])CCOCC1.[Rb+] |
| InChI | InChI=1S/C7H12NO2.C2H6.Rb/c1-6(9)7(8)2-4-10-5-3-7;1-2;/h8H,2-5H2,1H3;1-2H3;/q-1;;+1 |
| InChIKey | YUAPETMTDAGWKQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 50.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+)?
The IUPAC name of (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) (CID 156741367) is (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+).
What is the SMILES notation for (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+)?
The canonical SMILES for (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) is CC.CC(=O)C1([NH-])CCOCC1.[Rb+].
What is the InChIKey of (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+)?
The InChIKey is YUAPETMTDAGWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12NO2.C2H6.Rb/c1-6(9)7(8)2-4-10-5-3-7;1-2;/h8H,2-5H2,1H3;1-2H3;/q-1;;+1.
What are the key properties of (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+)?
(4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) has a molecular weight of 257.72 g/mol, XLogP of -0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxan-4-yl)azanide;ethane;rubidium(1+) is sourced from PubChem (CID 156741367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).