About 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane
4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane (PubChem CID 156742444) has the molecular formula C17H28ClN3
and a molecular weight of 309.89 g/mol. Its IUPAC name is 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane |
| PubChem CID | 156742444 |
| Molecular Formula | C17H28ClN3 |
| Molecular Weight | 309.89 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane |
| SMILES | CC.CN1CCCCCC1.Cc1nc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C8H7ClN2.C7H15N.C2H6/c1-5-10-7-4-2-3-6(9)8(7)11-5;1-8-6-4-2-3-5-7-8;1-2/h2-4H,1H3,(H,10,11);2-7H2,1H3;1-2H3 |
| InChIKey | CLRFJQAMPOWDIT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane?
The IUPAC name of 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane (CID 156742444) is 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane.
What is the SMILES notation for 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane?
The canonical SMILES for 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane is CC.CN1CCCCCC1.Cc1nc2c(Cl)cccc2[nH]1.
What is the InChIKey of 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane?
The InChIKey is CLRFJQAMPOWDIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2.C7H15N.C2H6/c1-5-10-7-4-2-3-6(9)8(7)11-5;1-8-6-4-2-3-5-7-8;1-2/h2-4H,1H3,(H,10,11);2-7H2,1H3;1-2H3.
What are the key properties of 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane?
4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane has a molecular weight of 309.89 g/mol, XLogP of 5.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-1H-benzimidazole;ethane;1-methylazepane is sourced from PubChem (CID 156742444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).