About 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane
4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane (PubChem CID 156742549) has the molecular formula C20H21F6NO
and a molecular weight of 405.38 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane.
Molecular Properties
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane |
| PubChem CID | 156742549 |
| Molecular Formula | C20H21F6NO |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane |
| SMILES | CC.CN1Cc2cccc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2C1 |
| InChI | InChI=1S/C18H15F6NO.C2H6/c1-25-8-12-3-2-4-16(15(12)9-25)26-10-11-5-13(17(19,20)21)7-14(6-11)18(22,23)24;1-2/h2-7H,8-10H2,1H3;1-2H3 |
| InChIKey | RTVFNXYSEGKCNN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane?
The IUPAC name of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane (CID 156742549) is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane.
What is the SMILES notation for 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane?
The canonical SMILES for 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane is CC.CN1Cc2cccc(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2C1.
What is the InChIKey of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane?
The InChIKey is RTVFNXYSEGKCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F6NO.C2H6/c1-25-8-12-3-2-4-16(15(12)9-25)26-10-11-5-13(17(19,20)21)7-14(6-11)18(22,23)24;1-2/h2-7H,8-10H2,1H3;1-2H3.
What are the key properties of 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane?
4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane has a molecular weight of 405.38 g/mol, XLogP of 6.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-methyl-1,3-dihydroisoindole;ethane is sourced from PubChem (CID 156742549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).