C24H35N — CID 156742635
3-(1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)-N-ethenyl-2-methylidenebut-3-en-1-imine (PubChem CID 156742635) has the molecular formula C24H35N and a molecular weight of 337.55 g/mol. Its IUPAC name is 3-(1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)-N-ethenyl-2-methylidenebut-3-en-1-imine.
| Compound Name | 3-(1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)-N-ethenyl-2-methylidenebut-3-en-1-imine |
|---|---|
| PubChem CID | 156742635 |
| Molecular Formula | C24H35N |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 3-(1,2,4b-trimethyl-1,3,4,4a,5,6,7,8,10,10a-decahydrophenanthren-2-yl)-N-ethenyl-2-methylidenebut-3-en-1-imine |
| SMILES | C=C/N=C/C(=C)C(=C)C1(C)CCC2C(CC=C3CCCCC32C)C1C |
| InChI | InChI=1S/C24H35N/c1-7-25-16-17(2)18(3)23(5)15-13-22-21(19(23)4)12-11-20-10-8-9-14-24(20,22)6/h7,11,16,19,21-22H,1-3,8-10,12-15H2,4-6H3/b25-16+ |
| InChIKey | RRXCILKXESIGCX-PCLIKHOPSA-N |
| XLogP | 6.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|