C34H49N5O5 — CID 156742951
tert-butyl N-[1-[cyclopropyl(pyridin-3-yl)methyl]-4,4-diethyl-6-oxo-5H-pyrimidin-2-yl]carbamate;N-(2,2-dimethyl-3,4,7,8-tetrahydrochromen-4-yl)formamide (PubChem CID 156742951) has the molecular formula C34H49N5O5 and a molecular weight of 607.80 g/mol. Its IUPAC name is tert-butyl N-[1-[cyclopropyl(pyridin-3-yl)methyl]-4,4-diethyl-6-oxo-5H-pyrimidin-2-yl]carbamate;N-(2,2-dimethyl-3,4,7,8-tetrahydrochromen-4-yl)formamide.
| Compound Name | tert-butyl N-[1-[cyclopropyl(pyridin-3-yl)methyl]-4,4-diethyl-6-oxo-5H-pyrimidin-2-yl]carbamate;N-(2,2-dimethyl-3,4,7,8-tetrahydrochromen-4-yl)formamide |
|---|---|
| PubChem CID | 156742951 |
| Molecular Formula | C34H49N5O5 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | tert-butyl N-[1-[cyclopropyl(pyridin-3-yl)methyl]-4,4-diethyl-6-oxo-5H-pyrimidin-2-yl]carbamate;N-(2,2-dimethyl-3,4,7,8-tetrahydrochromen-4-yl)formamide |
| SMILES | CC1(C)CC(NC=O)C2=C(CCC=C2)O1.CCC1(CC)CC(=O)N(C(c2cccnc2)C2CC2)C(NC(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C22H32N4O3.C12H17NO2/c1-6-22(7-2)13-17(27)26(19(25-22)24-20(28)29-21(3,4)5)18(15-10-11-15)16-9-8-12-23-14-16;1-12(2)7-10(13-8-14)9-5-3-4-6-11(9)15-12/h8-9,12,14-15,18H,6-7,10-11,13H2,1-5H3,(H,24,25,28);3,5,8,10H,4,6-7H2,1-2H3,(H,13,14) |
| InChIKey | DPLMNKMHYMLEIO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|