C26H30N6O2 — CID 156743799
2-[4-(methylamino)butan-2-ylamino]ethyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-3-carboxylate (PubChem CID 156743799) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 2-[4-(methylamino)butan-2-ylamino]ethyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-3-carboxylate.
| Compound Name | 2-[4-(methylamino)butan-2-ylamino]ethyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 156743799 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[4-(methylamino)butan-2-ylamino]ethyl 6-[5-(6-methyl-2-pyridinyl)-1H-imidazol-4-yl]quinoline-3-carboxylate |
| SMILES | CNCCC(C)NCCOC(=O)c1cnc2ccc(-c3nc[nH]c3-c3cccc(C)n3)cc2c1 |
| InChI | InChI=1S/C26H30N6O2/c1-17(9-10-27-3)28-11-12-34-26(33)21-14-20-13-19(7-8-22(20)29-15-21)24-25(31-16-30-24)23-6-4-5-18(2)32-23/h4-8,13-17,27-28H,9-12H2,1-3H3,(H,30,31) |
| InChIKey | DDIYBLWMJXWSEU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|