C19H34N2 — CID 156743877
(1Z,4Z)-2-buta-1,3-dien-2-yl-N-methyl-3-methylidene-4-(propan-2-ylideneamino)hexa-1,4-dien-1-amine;ethane (PubChem CID 156743877) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is (1Z,4Z)-2-buta-1,3-dien-2-yl-N-methyl-3-methylidene-4-(propan-2-ylideneamino)hexa-1,4-dien-1-amine;ethane.
| Compound Name | (1Z,4Z)-2-buta-1,3-dien-2-yl-N-methyl-3-methylidene-4-(propan-2-ylideneamino)hexa-1,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 156743877 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | (1Z,4Z)-2-buta-1,3-dien-2-yl-N-methyl-3-methylidene-4-(propan-2-ylideneamino)hexa-1,4-dien-1-amine;ethane |
| SMILES | C=CC(=C)C(=CNC)C(=C)/C(=C/C)N=C(C)C.CC.CC |
| InChI | InChI=1S/C15H22N2.2C2H6/c1-8-12(5)14(10-16-7)13(6)15(9-2)17-11(3)4;2*1-2/h8-10,16H,1,5-6H2,2-4,7H3;2*1-2H3/b14-10-,15-9-;; |
| InChIKey | LAUPJXLKNKMGLN-NJGVGQBKSA-N |
| XLogP | 5.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|