C18H26N2O2 — CID 156744603
N-(4-formamido-2,2,4-trimethylpentyl)cyclooctatetraenecarboxamide (PubChem CID 156744603) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(4-formamido-2,2,4-trimethylpentyl)cyclooctatetraenecarboxamide.
| Compound Name | N-(4-formamido-2,2,4-trimethylpentyl)cyclooctatetraenecarboxamide |
|---|---|
| PubChem CID | 156744603 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-(4-formamido-2,2,4-trimethylpentyl)cyclooctatetraenecarboxamide |
| SMILES | CC(C)(CNC(=O)C1=C/C=C\C=C/C=C\1)CC(C)(C)NC=O |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,12-18(3,4)20-14-21)13-19-16(22)15-10-8-6-5-7-9-11-15/h5-11,14H,12-13H2,1-4H3,(H,19,22)(H,20,21)/b6-5-,7-5-,8-6-,9-7-,10-8-,11-9-,15-10+,15-11+ |
| InChIKey | XKZYXVBLAKXZBP-OVCVTKFOSA-N |
| XLogP | 2.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|