C23H26N4O — CID 156744645
4-(4,8-dimethyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl)-1-ethyl-1,8-naphthyridin-2-one (PubChem CID 156744645) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-(4,8-dimethyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl)-1-ethyl-1,8-naphthyridin-2-one.
| Compound Name | 4-(4,8-dimethyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl)-1-ethyl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 156744645 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-(4,8-dimethyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl)-1-ethyl-1,8-naphthyridin-2-one |
| SMILES | CCn1c(=O)cc(N2CC(C)N3Cc4cc(C)ccc4C3C2)c2cccnc21 |
| InChI | InChI=1S/C23H26N4O/c1-4-26-22(28)11-20(19-6-5-9-24-23(19)26)25-12-16(3)27-13-17-10-15(2)7-8-18(17)21(27)14-25/h5-11,16,21H,4,12-14H2,1-3H3 |
| InChIKey | ZYFSLUBPDCTSEW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |