C19H15F6N6O2S+ — CID 156744670
[3,5-bis(trifluoromethyl)benzoyl]-[(1S)-1-[2-(5-carbamoyl-1,3-thiazol-2-yl)-5-methyl-1,2,4-triazol-3-yl]ethyl]-methylideneazanium (PubChem CID 156744670) has the molecular formula C19H15F6N6O2S+ and a molecular weight of 505.42 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)benzoyl]-[(1S)-1-[2-(5-carbamoyl-1,3-thiazol-2-yl)-5-methyl-1,2,4-triazol-3-yl]ethyl]-methylideneazanium.
| Compound Name | [3,5-bis(trifluoromethyl)benzoyl]-[(1S)-1-[2-(5-carbamoyl-1,3-thiazol-2-yl)-5-methyl-1,2,4-triazol-3-yl]ethyl]-methylideneazanium |
|---|---|
| PubChem CID | 156744670 |
| Molecular Formula | C19H15F6N6O2S+ |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | [3,5-bis(trifluoromethyl)benzoyl]-[(1S)-1-[2-(5-carbamoyl-1,3-thiazol-2-yl)-5-methyl-1,2,4-triazol-3-yl]ethyl]-methylideneazanium |
| SMILES | C=[N+](C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H](C)c1nc(C)nn1-c1ncc(C(N)=O)s1 |
| InChI | InChI=1S/C19H14F6N6O2S/c1-8(15-28-9(2)29-31(15)17-27-7-13(34-17)14(26)32)30(3)16(33)10-4-11(18(20,21)22)6-12(5-10)19(23,24)25/h4-8H,3H2,1-2H3,(H-,26,32)/p+1/t8-/m0/s1 |
| InChIKey | CYEGFRNRIGLHIO-QMMMGPOBSA-O |
| XLogP | 3.78 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|