C23H20BCl2N6O3S2 — CID 156744750
CID 156744750 (PubChem CID 156744750) has the molecular formula C23H20BCl2N6O3S2 and a molecular weight of 574.30 g/mol.
| Compound Name | CID 156744750 |
|---|---|
| PubChem CID | 156744750 |
| Molecular Formula | C23H20BCl2N6O3S2 |
| Molecular Weight | 574.30 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | — |
| SMILES | C[B]C.C[C@H](NC(=O)c1cc(Cl)cc(S(=O)(=O)c2ccc(Cl)cc2)c1)c1ncnn1-c1ncc(C#N)s1 |
| InChI | InChI=1S/C21H14Cl2N6O3S2.C2H6B/c1-12(19-26-11-27-29(19)21-25-10-16(9-24)33-21)28-20(30)13-6-15(23)8-18(7-13)34(31,32)17-4-2-14(22)3-5-17;1-3-2/h2-8,10-12H,1H3,(H,28,30);1-2H3/t12-;/m0./s1 |
| InChIKey | LBAASNFFTXQLEF-YDALLXLXSA-N |
| XLogP | 5.01 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|