C24H25FN4O3 — CID 156745399
tert-butyl N-[2-(3-fluoroanilino)-6-[(3-methylphenyl)carbamoyl]-4-pyridinyl]carbamate (PubChem CID 156745399) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is tert-butyl N-[2-(3-fluoroanilino)-6-[(3-methylphenyl)carbamoyl]-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-fluoroanilino)-6-[(3-methylphenyl)carbamoyl]-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 156745399 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | tert-butyl N-[2-(3-fluoroanilino)-6-[(3-methylphenyl)carbamoyl]-4-pyridinyl]carbamate |
| SMILES | Cc1cccc(NC(=O)c2cc(NC(=O)OC(C)(C)C)cc(Nc3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C24H25FN4O3/c1-15-7-5-9-17(11-15)27-22(30)20-13-19(28-23(31)32-24(2,3)4)14-21(29-20)26-18-10-6-8-16(25)12-18/h5-14H,1-4H3,(H,27,30)(H2,26,28,29,31) |
| InChIKey | RFNCFXCHBHKYOO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |