About cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine
cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine (PubChem CID 156745900) has the molecular formula C12H20F2N4
and a molecular weight of 258.32 g/mol. Its IUPAC name is cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine |
| PubChem CID | 156745900 |
| Molecular Formula | C12H20F2N4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine |
| SMILES | CC(C)Cc1cn([C@H]2CCCC(F)(F)[C@@H]2N)nn1 |
| InChI | InChI=1S/C12H20F2N4/c1-8(2)6-9-7-18(17-16-9)10-4-3-5-12(13,14)11(10)15/h7-8,10-11H,3-6,15H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | JTGKHFGGPSWHKY-WDEREUQCSA-N |
| XLogP | 2.16 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine?
The IUPAC name of cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine (CID 156745900) is cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine.
What is the SMILES notation for cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine?
The canonical SMILES for cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine is CC(C)Cc1cn([C@H]2CCCC(F)(F)[C@@H]2N)nn1.
What is the InChIKey of cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine?
The InChIKey is JTGKHFGGPSWHKY-WDEREUQCSA-N. The full InChI is InChI=1S/C12H20F2N4/c1-8(2)6-9-7-18(17-16-9)10-4-3-5-12(13,14)11(10)15/h7-8,10-11H,3-6,15H2,1-2H3/t10-,11+/m0/s1.
What are the key properties of cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine?
cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine has a molecular weight of 258.32 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,6S)-2,2-difluoro-6-[4-(2-methylpropyl)triazol-1-yl]cyclohexan-1-amine is sourced from PubChem (CID 156745900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).