C16H20N2O2 — CID 156746164
ethyl 3-[(cyclobutylamino)methyl]-1H-indole-2-carboxylate (PubChem CID 156746164) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is ethyl 3-[(cyclobutylamino)methyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[(cyclobutylamino)methyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 156746164 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethyl 3-[(cyclobutylamino)methyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1CNC1CCC1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-20-16(19)15-13(10-17-11-6-5-7-11)12-8-3-4-9-14(12)18-15/h3-4,8-9,11,17-18H,2,5-7,10H2,1H3 |
| InChIKey | AGAFDUFKBXTOEX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|