C24H23BF3N5O9 — CID 156746309
(3R)-3-[[(2R)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,3,5-trifluoro-4-hydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746309) has the molecular formula C24H23BF3N5O9 and a molecular weight of 593.28 g/mol. Its IUPAC name is (3R)-3-[[(2R)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,3,5-trifluoro-4-hydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2R)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,3,5-trifluoro-4-hydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746309 |
| Molecular Formula | C24H23BF3N5O9 |
| Molecular Weight | 593.28 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | (3R)-3-[[(2R)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,3,5-trifluoro-4-hydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NCCN1CCN(C(=O)N[C@@H](C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2cc(F)c(O)c(F)c2F)C(=O)C1=O |
| InChI | InChI=1S/C24H23BF3N5O9/c26-13-9-12(15(27)16(28)18(13)34)17(31-24(40)33-7-6-32(5-4-29)21(36)22(33)37)20(35)30-14-8-10-2-1-3-11(23(38)39)19(10)42-25(14)41/h1-3,9,14,17,34,41H,4-8,29H2,(H,30,35)(H,31,40)(H,38,39)/t14-,17+/m0/s1 |
| InChIKey | AGGCSEJVCCOBMN-WMLDXEAASA-N |
| XLogP | -0.97 |
| TPSA | 211.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.28 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|