C25H25BF2N4O9 — CID 156746311
(3R)-3-[[2-(2,3-difluoro-4-hydroxyphenyl)-2-[[(6S)-4-ethyl-6-methyl-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746311) has the molecular formula C25H25BF2N4O9 and a molecular weight of 574.30 g/mol. Its IUPAC name is (3R)-3-[[2-(2,3-difluoro-4-hydroxyphenyl)-2-[[(6S)-4-ethyl-6-methyl-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(2,3-difluoro-4-hydroxyphenyl)-2-[[(6S)-4-ethyl-6-methyl-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746311 |
| Molecular Formula | C25H25BF2N4O9 |
| Molecular Weight | 574.30 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | (3R)-3-[[2-(2,3-difluoro-4-hydroxyphenyl)-2-[[(6S)-4-ethyl-6-methyl-2,3-dioxopiperazine-1-carbonyl]amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1C[C@H](C)N(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2ccc(O)c(F)c2F)C(=O)C1=O |
| InChI | InChI=1S/C25H25BF2N4O9/c1-3-31-10-11(2)32(23(36)22(31)35)25(39)30-19(13-7-8-15(33)18(28)17(13)27)21(34)29-16-9-12-5-4-6-14(24(37)38)20(12)41-26(16)40/h4-8,11,16,19,33,40H,3,9-10H2,1-2H3,(H,29,34)(H,30,39)(H,37,38)/t11-,16-,19?/m0/s1 |
| InChIKey | AIFLZPRODHGQQU-KABNBSCRSA-N |
| XLogP | 0.34 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|