C28H43BO9S — CID 156746318
3-[[(3aS)-3a,4,5,5-tetramethyl-6,6a-dihydro-4H-cyclopenta[d][1,3,2]dioxaborol-2-yl]methyl]-6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid (PubChem CID 156746318) has the molecular formula C28H43BO9S and a molecular weight of 566.52 g/mol. Its IUPAC name is 3-[[(3aS)-3a,4,5,5-tetramethyl-6,6a-dihydro-4H-cyclopenta[d][1,3,2]dioxaborol-2-yl]methyl]-6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid.
| Compound Name | 3-[[(3aS)-3a,4,5,5-tetramethyl-6,6a-dihydro-4H-cyclopenta[d][1,3,2]dioxaborol-2-yl]methyl]-6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid |
|---|---|
| PubChem CID | 156746318 |
| Molecular Formula | C28H43BO9S |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 3-[[(3aS)-3a,4,5,5-tetramethyl-6,6a-dihydro-4H-cyclopenta[d][1,3,2]dioxaborol-2-yl]methyl]-6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoic acid |
| SMILES | CCOC(CSc1ccc(CB2OC3CC(C)(C)C(C)[C@]3(C)O2)c(OC(=O)OC(C)(C)C)c1C(=O)O)OCC |
| InChI | InChI=1S/C28H43BO9S/c1-10-33-21(34-11-2)16-39-19-13-12-18(23(22(19)24(30)31)35-25(32)36-26(4,5)6)15-29-37-20-14-27(7,8)17(3)28(20,9)38-29/h12-13,17,20-21H,10-11,14-16H2,1-9H3,(H,30,31)/t17?,20?,28-/m0/s1 |
| InChIKey | ZPYVBJUMYYIPIZ-RGSJVASWSA-N |
| XLogP | 6.00 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|