C25H24BN5O12 — CID 156746321
(3R)-3-[[2-(4-carboxy-3-nitrophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746321) has the molecular formula C25H24BN5O12 and a molecular weight of 597.30 g/mol. Its IUPAC name is (3R)-3-[[2-(4-carboxy-3-nitrophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(4-carboxy-3-nitrophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746321 |
| Molecular Formula | C25H24BN5O12 |
| Molecular Weight | 597.30 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | (3R)-3-[[2-(4-carboxy-3-nitrophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2ccc(C(=O)O)c([N+](=O)[O-])c2)C(=O)C1=O |
| InChI | InChI=1S/C25H24BN5O12/c1-2-29-8-9-30(22(34)21(29)33)25(39)28-18(12-6-7-14(23(35)36)16(10-12)31(41)42)20(32)27-17-11-13-4-3-5-15(24(37)38)19(13)43-26(17)40/h3-7,10,17-18,40H,2,8-9,11H2,1H3,(H,27,32)(H,28,39)(H,35,36)(H,37,38)/t17-,18?/m0/s1 |
| InChIKey | ZCSJKSPFWOHATD-ZENAZSQFSA-N |
| XLogP | -0.43 |
| TPSA | 246.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|