C28H38BF3O7 — CID 156746337
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate (PubChem CID 156746337) has the molecular formula C28H38BF3O7 and a molecular weight of 554.41 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 156746337 |
| Molecular Formula | C28H38BF3O7 |
| Molecular Weight | 554.41 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)Oc1c(CB2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)ccc(C(F)(F)F)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38BF3O7/c1-24(2,3)36-22(33)20-17(28(30,31)32)11-10-15(21(20)35-23(34)37-25(4,5)6)14-29-38-19-13-16-12-18(26(16,7)8)27(19,9)39-29/h10-11,16,18-19H,12-14H2,1-9H3/t16-,18-,19+,27-/m0/s1 |
| InChIKey | DBCLCGXKYYAQOF-FBDNSDSYSA-N |
| XLogP | 6.78 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.41 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|