C25H23BF2N4O10 — CID 156746348
(3R)-3-[[2-(4-carboxy-3,5-difluorophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746348) has the molecular formula C25H23BF2N4O10 and a molecular weight of 588.29 g/mol. Its IUPAC name is (3R)-3-[[2-(4-carboxy-3,5-difluorophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(4-carboxy-3,5-difluorophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746348 |
| Molecular Formula | C25H23BF2N4O10 |
| Molecular Weight | 588.29 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (3R)-3-[[2-(4-carboxy-3,5-difluorophenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2cc(F)c(C(=O)O)c(F)c2)C(=O)C1=O |
| InChI | InChI=1S/C25H23BF2N4O10/c1-2-31-6-7-32(22(35)21(31)34)25(40)30-18(12-8-14(27)17(24(38)39)15(28)9-12)20(33)29-16-10-11-4-3-5-13(23(36)37)19(11)42-26(16)41/h3-5,8-9,16,18,41H,2,6-7,10H2,1H3,(H,29,33)(H,30,40)(H,36,37)(H,38,39)/t16-,18?/m0/s1 |
| InChIKey | MFHKZWVBAVWGBK-ATNAJCNCSA-N |
| XLogP | -0.06 |
| TPSA | 202.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|