C17H16BF2N5O6 — CID 156746366
(3R)-3-[[2-(diaminomethylideneamino)-2-(3-fluoro-5-hydroxy-2-pyridinyl)acetyl]amino]-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746366) has the molecular formula C17H16BF2N5O6 and a molecular weight of 435.15 g/mol. Its IUPAC name is (3R)-3-[[2-(diaminomethylideneamino)-2-(3-fluoro-5-hydroxy-2-pyridinyl)acetyl]amino]-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(diaminomethylideneamino)-2-(3-fluoro-5-hydroxy-2-pyridinyl)acetyl]amino]-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746366 |
| Molecular Formula | C17H16BF2N5O6 |
| Molecular Weight | 435.15 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (3R)-3-[[2-(diaminomethylideneamino)-2-(3-fluoro-5-hydroxy-2-pyridinyl)acetyl]amino]-7-fluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NC(N)=NC(C(=O)N[C@H]1Cc2ccc(F)c(C(=O)O)c2OB1O)c1ncc(O)cc1F |
| InChI | InChI=1S/C17H16BF2N5O6/c19-8-2-1-6-3-10(18(30)31-14(6)11(8)16(28)29)24-15(27)13(25-17(21)22)12-9(20)4-7(26)5-23-12/h1-2,4-5,10,13,26,30H,3H2,(H,24,27)(H,28,29)(H4,21,22,25)/t10-,13?/m0/s1 |
| InChIKey | ANDLNMNOINTPNY-NKUHCKNESA-N |
| XLogP | -0.78 |
| TPSA | 193.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|