C33H51BO9S — CID 156746408
tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate (PubChem CID 156746408) has the molecular formula C33H51BO9S and a molecular weight of 634.64 g/mol. Its IUPAC name is tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate.
| Compound Name | tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 156746408 |
| Molecular Formula | C33H51BO9S |
| Molecular Weight | 634.64 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | tert-butyl 6-(2,2-diethoxyethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-3-[[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
| SMILES | CCOC(CSc1ccc(CB2OC3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)c(OC(=O)OC(C)(C)C)c1C(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C33H51BO9S/c1-12-37-25(38-13-2)19-44-22-15-14-20(18-34-42-24-17-21-16-23(32(21,9)10)33(24,11)43-34)27(39-29(36)41-31(6,7)8)26(22)28(35)40-30(3,4)5/h14-15,21,23-25H,12-13,16-19H2,1-11H3/t21-,23-,24?,33-/m0/s1 |
| InChIKey | GLQNQXNQKMAEDJ-BQAGBXQUSA-N |
| XLogP | 7.26 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|