C22H36O4 — CID 15674659
[(1R,2E,6E,8R,10S,11E,13S)-8,13-dihydroxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-yl] acetate (PubChem CID 15674659) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1R,2E,6E,8R,10S,11E,13S)-8,13-dihydroxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-yl] acetate.
| Compound Name | [(1R,2E,6E,8R,10S,11E,13S)-8,13-dihydroxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-yl] acetate |
|---|---|
| PubChem CID | 15674659 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1R,2E,6E,8R,10S,11E,13S)-8,13-dihydroxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C(/C)CC/C=C(\C)[C@H](O)C[C@@H](C(C)C)/C=C/[C@@](C)(O)C1 |
| InChI | InChI=1S/C22H36O4/c1-15(2)19-10-11-22(6,25)14-20(26-18(5)23)12-16(3)8-7-9-17(4)21(24)13-19/h9-12,15,19-21,24-25H,7-8,13-14H2,1-6H3/b11-10+,16-12-,17-9+/t19-,20-,21+,22+/m0/s1 |
| InChIKey | CLLDSYFHQCFUQA-BQVTYIBBSA-N |
| XLogP | 4.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|