C30H45BO7S — CID 156746636
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate (PubChem CID 156746636) has the molecular formula C30H45BO7S and a molecular weight of 560.56 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate |
|---|---|
| PubChem CID | 156746636 |
| Molecular Formula | C30H45BO7S |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate |
| SMILES | CSc1ccc(C[C@@H](C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)c(OC(=O)OC(C)(C)C)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45BO7S/c1-17(31-37-22-16-19-15-21(29(19,8)9)30(22,10)38-31)14-18-12-13-20(39-11)23(25(32)35-27(2,3)4)24(18)34-26(33)36-28(5,6)7/h12-13,17,19,21-22H,14-16H2,1-11H3/t17-,19+,21+,22-,30+/m1/s1 |
| InChIKey | HMMLSGCMKYNTKR-OWHXOOLLSA-N |
| XLogP | 7.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|