C24H24BF2N5O8 — CID 156746697
(3R)-3-[[(2S)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,6-difluorophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 156746697) has the molecular formula C24H24BF2N5O8 and a molecular weight of 559.29 g/mol. Its IUPAC name is (3R)-3-[[(2S)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,6-difluorophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2S)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,6-difluorophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 156746697 |
| Molecular Formula | C24H24BF2N5O8 |
| Molecular Weight | 559.29 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (3R)-3-[[(2S)-2-[[4-(2-aminoethyl)-2,3-dioxopiperazine-1-carbonyl]amino]-2-(2,6-difluorophenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NCCN1CCN(C(=O)N[C@H](C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2c(F)cccc2F)C(=O)C1=O |
| InChI | InChI=1S/C24H24BF2N5O8/c26-14-5-2-6-15(27)17(14)18(30-24(38)32-10-9-31(8-7-28)21(34)22(32)35)20(33)29-16-11-12-3-1-4-13(23(36)37)19(12)40-25(16)39/h1-6,16,18,39H,7-11,28H2,(H,29,33)(H,30,38)(H,36,37)/t16-,18-/m0/s1 |
| InChIKey | UDEFSLUJGNRWGR-WMZOPIPTSA-N |
| XLogP | -0.82 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|