C30H42BF3O7 — CID 156746707
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate (PubChem CID 156746707) has the molecular formula C30H42BF3O7 and a molecular weight of 582.47 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate |
|---|---|
| PubChem CID | 156746707 |
| Molecular Formula | C30H42BF3O7 |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-(trifluoromethyl)-3-[(2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]benzoate |
| SMILES | C[C@H](Cc1ccc(C(F)(F)F)c(C(=O)OC(C)(C)C)c1OC(=O)OC(C)(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C30H42BF3O7/c1-16(31-40-21-15-18-14-20(28(18,8)9)29(21,10)41-31)13-17-11-12-19(30(32,33)34)22(24(35)38-26(2,3)4)23(17)37-25(36)39-27(5,6)7/h11-12,16,18,20-21H,13-15H2,1-10H3/t16-,18+,20+,21-,29+/m1/s1 |
| InChIKey | BXLSXKGPCRSEAZ-ROLBRQCNSA-N |
| XLogP | 7.64 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|