C12H13BrN2S — CID 156747131
5-bromo-4-piperidin-1-ylthieno[2,3-b]pyridine (PubChem CID 156747131) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 5-bromo-4-piperidin-1-ylthieno[2,3-b]pyridine.
| Compound Name | 5-bromo-4-piperidin-1-ylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 156747131 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 5-bromo-4-piperidin-1-ylthieno[2,3-b]pyridine |
| SMILES | Brc1cnc2sccc2c1N1CCCCC1 |
| InChI | InChI=1S/C12H13BrN2S/c13-10-8-14-12-9(4-7-16-12)11(10)15-5-2-1-3-6-15/h4,7-8H,1-3,5-6H2 |
| InChIKey | COINDFKFLWZEJT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |