C21H26F2N2O5S — CID 156747253
(NE)-N-[(16R)-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-ylidene]methanesulfonamide (PubChem CID 156747253) has the molecular formula C21H26F2N2O5S and a molecular weight of 456.51 g/mol. Its IUPAC name is (NE)-N-[(16R)-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-ylidene]methanesulfonamide.
| Compound Name | (NE)-N-[(16R)-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 156747253 |
| Molecular Formula | C21H26F2N2O5S |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (NE)-N-[(16R)-4,6-difluoro-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2(7),3,5-trien-15-ylidene]methanesulfonamide |
| SMILES | CS(=O)(=O)/N=C1\CCCN2C(=O)COc3c(F)cc(F)cc3C3CCC(CC3)OC[C@@H]12 |
| InChI | InChI=1S/C21H26F2N2O5S/c1-31(27,28)24-18-3-2-8-25-19(18)11-29-15-6-4-13(5-7-15)16-9-14(22)10-17(23)21(16)30-12-20(25)26/h9-10,13,15,19H,2-8,11-12H2,1H3/b24-18+/t13?,15?,19-/m0/s1 |
| InChIKey | HKSRJJKRHGTUKL-FUGRNZALSA-N |
| XLogP | 2.79 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|