C20H30N2O6S — CID 156747275
N-[(2R,3S)-2-[[4-hydroxy-4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 156747275) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[(2R,3S)-2-[[4-hydroxy-4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[(2R,3S)-2-[[4-hydroxy-4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 156747275 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[(2R,3S)-2-[[4-hydroxy-4-[2-(2-oxoethoxy)phenyl]cyclohexyl]oxymethyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCN[C@H]1COC1CCC(O)(c2ccccc2OCC=O)CC1 |
| InChI | InChI=1S/C20H30N2O6S/c1-29(25,26)22-17-8-11-21-18(17)14-28-15-6-9-20(24,10-7-15)16-4-2-3-5-19(16)27-13-12-23/h2-5,12,15,17-18,21-22,24H,6-11,13-14H2,1H3/t15?,17-,18-,20?/m0/s1 |
| InChIKey | BAZNONBJLBDXFS-WFUSOUOQSA-N |
| XLogP | 0.69 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|