C22H30N2O5S — CID 156747324
(NE)-N-[(9R)-9-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-ylidene]methanesulfonamide (PubChem CID 156747324) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is (NE)-N-[(9R)-9-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-ylidene]methanesulfonamide.
| Compound Name | (NE)-N-[(9R)-9-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 156747324 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (NE)-N-[(9R)-9-methyl-10-oxo-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-trien-15-ylidene]methanesulfonamide |
| SMILES | C[C@H]1Oc2ccccc2C2CCC(CC2)OCC2/C(=N/S(C)(=O)=O)CCCN2C1=O |
| InChI | InChI=1S/C22H30N2O5S/c1-15-22(25)24-13-5-7-19(23-30(2,26)27)20(24)14-28-17-11-9-16(10-12-17)18-6-3-4-8-21(18)29-15/h3-4,6,8,15-17,20H,5,7,9-14H2,1-2H3/b23-19+/t15-,16?,17?,20?/m1/s1 |
| InChIKey | QMSMXMRRBIKPBA-ZLWFRWLCSA-N |
| XLogP | 2.90 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|