About 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane
2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane (PubChem CID 156747378) has the molecular formula C14H32NO9P
and a molecular weight of 389.38 g/mol. Its IUPAC name is 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane.
Molecular Properties
| Compound Name | 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane |
| PubChem CID | 156747378 |
| Molecular Formula | C14H32NO9P |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane |
| SMILES | CC.COOP(=O)(OC)OCCOCCOCCOCCNC(C)=O |
| InChI | InChI=1S/C12H26NO9P.C2H6/c1-12(14)13-4-5-18-6-7-19-8-9-20-10-11-21-23(15,17-3)22-16-2;1-2/h4-11H2,1-3H3,(H,13,14);1-2H3 |
| InChIKey | ITRSLYUIBPTCBJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane?
The IUPAC name of 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane (CID 156747378) is 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane.
What is the SMILES notation for 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane?
The canonical SMILES for 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane is CC.COOP(=O)(OC)OCCOCCOCCOCCNC(C)=O.
What is the InChIKey of 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane?
The InChIKey is ITRSLYUIBPTCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26NO9P.C2H6/c1-12(14)13-4-5-18-6-7-19-8-9-20-10-11-21-23(15,17-3)22-16-2;1-2/h4-11H2,1-3H3,(H,13,14);1-2H3.
What are the key properties of 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane?
2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane has a molecular weight of 389.38 g/mol, XLogP of 1.55, 16 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl methoxy methyl phosphate;ethane is sourced from PubChem (CID 156747378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).