About 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide
6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide (PubChem CID 156747420) has the molecular formula C31H63N3O2
and a molecular weight of 509.86 g/mol. Its IUPAC name is 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide.
Molecular Properties
| Compound Name | 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide |
| PubChem CID | 156747420 |
| Molecular Formula | C31H63N3O2 |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 509.49 |
| IUPAC Name | 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide |
| SMILES | C=C(CC)NCCCCCC(=O)NCCCCC.CCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C16H33NO.C15H30N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-4-6-9-13-17-15(18)11-8-7-10-12-16-14(3)5-2/h2-15H2,1H3,(H2,17,18);16H,3-13H2,1-2H3,(H,17,18) |
| InChIKey | ZRHHGEMPXVWIGO-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide?
The IUPAC name of 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide (CID 156747420) is 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide.
What is the SMILES notation for 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide?
The canonical SMILES for 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide is C=C(CC)NCCCCCC(=O)NCCCCC.CCCCCCCCCCCCCCCC(N)=O.
What is the InChIKey of 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide?
The InChIKey is ZRHHGEMPXVWIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO.C15H30N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-4-6-9-13-17-15(18)11-8-7-10-12-16-14(3)5-2/h2-15H2,1H3,(H2,17,18);16H,3-13H2,1-2H3,(H,17,18).
What are the key properties of 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide?
6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide has a molecular weight of 509.86 g/mol, XLogP of 8.32, 26 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(but-1-en-2-ylamino)-N-pentylhexanamide;hexadecanamide is sourced from PubChem (CID 156747420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).