C16H16F3N5O4 — CID 156747480
N-[6,8-dioxo-7-prop-2-ynyl-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-1H-purin-2-yl]acetamide (PubChem CID 156747480) has the molecular formula C16H16F3N5O4 and a molecular weight of 399.33 g/mol. Its IUPAC name is N-[6,8-dioxo-7-prop-2-ynyl-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-1H-purin-2-yl]acetamide.
| Compound Name | N-[6,8-dioxo-7-prop-2-ynyl-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 156747480 |
| Molecular Formula | C16H16F3N5O4 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[6,8-dioxo-7-prop-2-ynyl-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-1H-purin-2-yl]acetamide |
| SMILES | C#CCn1c(=O)n(C2CCC(CC(F)(F)F)O2)c2nc(NC(C)=O)[nH]c(=O)c21 |
| InChI | InChI=1S/C16H16F3N5O4/c1-3-6-23-11-12(21-14(20-8(2)25)22-13(11)26)24(15(23)27)10-5-4-9(28-10)7-16(17,18)19/h1,9-10H,4-7H2,2H3,(H2,20,21,22,25,26) |
| InChIKey | BJUUFLVEWQJYFV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|