C16H17F6N5O4 — CID 156747502
N-[6,8-dioxo-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purin-2-yl]acetamide (PubChem CID 156747502) has the molecular formula C16H17F6N5O4 and a molecular weight of 457.33 g/mol. Its IUPAC name is N-[6,8-dioxo-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purin-2-yl]acetamide.
| Compound Name | N-[6,8-dioxo-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 156747502 |
| Molecular Formula | C16H17F6N5O4 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[6,8-dioxo-9-[5-(2,2,2-trifluoroethyl)oxolan-2-yl]-7-(3,3,3-trifluoropropyl)-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(c(=O)[nH]1)n(CCC(F)(F)F)c(=O)n2C1CCC(CC(F)(F)F)O1 |
| InChI | InChI=1S/C16H17F6N5O4/c1-7(28)23-13-24-11-10(12(29)25-13)26(5-4-15(17,18)19)14(30)27(11)9-3-2-8(31-9)6-16(20,21)22/h8-9H,2-6H2,1H3,(H2,23,24,25,28,29) |
| InChIKey | QTXWLHGMXWKUIP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |