C16H24FN5O3 — CID 156747532
2-amino-7-butyl-9-(4-fluoro-5-propyloxolan-2-yl)-1H-purine-6,8-dione (PubChem CID 156747532) has the molecular formula C16H24FN5O3 and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-amino-7-butyl-9-(4-fluoro-5-propyloxolan-2-yl)-1H-purine-6,8-dione.
| Compound Name | 2-amino-7-butyl-9-(4-fluoro-5-propyloxolan-2-yl)-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 156747532 |
| Molecular Formula | C16H24FN5O3 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-amino-7-butyl-9-(4-fluoro-5-propyloxolan-2-yl)-1H-purine-6,8-dione |
| SMILES | CCCCn1c(=O)n(C2CC(F)C(CCC)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C16H24FN5O3/c1-3-5-7-21-12-13(19-15(18)20-14(12)23)22(16(21)24)11-8-9(17)10(25-11)6-4-2/h9-11H,3-8H2,1-2H3,(H3,18,19,20,23) |
| InChIKey | ZTJLBOLLFWUWBR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |