About 1,5-dimethoxycyclohepta-1,4-diene
1,5-dimethoxycyclohepta-1,4-diene (PubChem CID 156747546) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1,5-dimethoxycyclohepta-1,4-diene.
Molecular Properties
| Compound Name | 1,5-dimethoxycyclohepta-1,4-diene |
| PubChem CID | 156747546 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 1,5-dimethoxycyclohepta-1,4-diene |
| SMILES | COC1=CCC=C(OC)CC1 |
| InChI | InChI=1S/C9H14O2/c1-10-8-4-3-5-9(11-2)7-6-8/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | AATJGQNTPHJDED-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethoxycyclohepta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethoxycyclohepta-1,4-diene?
The IUPAC name of 1,5-dimethoxycyclohepta-1,4-diene (CID 156747546) is 1,5-dimethoxycyclohepta-1,4-diene.
What is the SMILES notation for 1,5-dimethoxycyclohepta-1,4-diene?
The canonical SMILES for 1,5-dimethoxycyclohepta-1,4-diene is COC1=CCC=C(OC)CC1.
What is the InChIKey of 1,5-dimethoxycyclohepta-1,4-diene?
The InChIKey is AATJGQNTPHJDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-10-8-4-3-5-9(11-2)7-6-8/h4-5H,3,6-7H2,1-2H3.
What are the key properties of 1,5-dimethoxycyclohepta-1,4-diene?
1,5-dimethoxycyclohepta-1,4-diene has a molecular weight of 154.21 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethoxycyclohepta-1,4-diene is sourced from PubChem (CID 156747546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).